| Product Name | 3,4,5-Trichlorothiophene-2-carbonyl chloride |
| CAS No. | 24422-15-9 |
| InChI | InChI=1/C5Cl4OS/c6-1-2(7)5(9)11-3(1)4(8)10 |
| Molecular Formula | C5Cl4OS |
| Molecular Weight | 249.9299 |
| Density | 1.77g/cm3 |
| Boiling point | 288.5°C at 760 mmHg |
| Flash point | 128.3°C |
| Refractive index | 1.619 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
24422-15-9 3,4,5-trichlorothiophene-2-carbonyl chloride
service@apichina.com