| Product Name | 3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid |
| CAS No. | 175278-50-9 |
| Synonyms | 3-[4-[(4-Methylphenyl)thio]-3-nitrophenyl]acrylic acid; (2E)-3-{4-[(4-methylphenyl)sulfanyl]-3-nitrophenyl}prop-2-enoic acid |
| InChI | InChI=1/C16H13NO4S/c1-11-2-6-13(7-3-11)22-15-8-4-12(5-9-16(18)19)10-14(15)17(20)21/h2-10H,1H3,(H,18,19)/b9-5+ |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.3437 |
| Density | 1.38g/cm3 |
| Melting point | 217℃ |
| Boiling point | 505°C at 760 mmHg |
| Flash point | 259.2°C |
| Refractive index | 1.673 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175278-50-9 3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid
service@apichina.com