| Product Name | 3-(3-Thienyl)acrylic acid |
| CAS No. | 1195-52-4 |
| Synonyms | Thiophene-3-acrylic acid; (2E)-3-thiophen-3-ylprop-2-enoate; (2Z)-3-(thiophen-3-yl)prop-2-enoic acid |
| InChI | InChI=1/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1- |
| Molecular Formula | C7H6O2S |
| Molecular Weight | 154.1863 |
| Density | 1.346g/cm3 |
| Boiling point | 298.896°C at 760 mmHg |
| Flash point | 134.568°C |
| Refractive index | 1.656 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1195-52-4 3-(3-thienyl)acrylic acid
service@apichina.com