| Product Name | 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid |
| CAS No. | 175278-41-8 |
| Synonyms | (2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid |
| InChI | InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+ |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.2613 |
| Density | 1.37g/cm3 |
| Melting point | 243℃ |
| Boiling point | 483.9°C at 760 mmHg |
| Flash point | 246.5°C |
| Refractive index | 1.657 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175278-41-8 3-(3-nitro-4-tetrahydro-1h-pyrrol-1-ylphenyl)acrylic acid
service@apichina.com