| Product Name | 3-(3-methoxyphenyl)propionic acid |
| CAS No. | 10516-71-9 |
| Synonyms | 3-Methoxyhydrocinnamic acid; 3-(3-methoxyphenyl)propanoic acid |
| InChI | InChI=1/C10H12O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| Density | 1.144g/cm3 |
| Melting point | 43-45℃ |
| Boiling point | 318.1°C at 760 mmHg |
| Flash point | 125.6°C |
| Refractive index | 1.53 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
10516-71-9 3-(3-methoxyphenyl)propionic acid
service@apichina.com