| Product Name | 3-(3-Hydroxyphenyl)propionic acid |
| CAS No. | 621-54-5 |
| Synonyms | 3-Hydroxyhydrocinnamic acid; 3-Hydroxyphenyl-propionic acid; 3-(3-hydroxyphenyl)propanoic acid |
| InChI | InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.1739 |
| Density | 1.26g/cm3 |
| Boiling point | 354.5°C at 760 mmHg |
| Flash point | 182.4°C |
| Refractive index | 1.58 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
621-54-5 3-(3-hydroxyphenyl)propionic acid
service@apichina.com