| Product Name | 3,3-dimethylindan-5-ol |
| CAS No. | 4957-24-8 |
| Synonyms | 3,3-Dimethylindan-5-ol; 3,3-dimethyl-2,3-dihydro-1H-inden-5-ol |
| InChI | InChI=1/C11H14O/c1-11(2)6-5-8-3-4-9(12)7-10(8)11/h3-4,7,12H,5-6H2,1-2H3 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.2283 |
| Density | 1.044g/cm3 |
| Boiling point | 260.7°C at 760 mmHg |
| Flash point | 118.6°C |
| Refractive index | 1.551 |
4957-24-8 3,3-dimethylindan-5-ol
service@apichina.com