| Product Name | 3,3-diethoxy-1-propyne |
| CAS No. | 10160-87-9 |
| Synonyms | Propiolaldehyde diethyl acetal; Propargylaldehyde diethyl acetal; 3,3-diethoxyprop-1-yne; Propynal diethyl acetal |
| InChI | InChI=1/C7H12O2/c1-4-7(8-5-2)9-6-3/h1,7H,5-6H2,2-3H3 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.169 |
| Density | 0.909g/cm3 |
| Boiling point | 139°C at 760 mmHg |
| Flash point | 32.2°C |
| Refractive index | 1.421 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
10160-87-9 3,3-diethoxy-1-propyne
service@apichina.com