| Product Name | 3-(2-thienyl)benzoic acid |
| CAS No. | 29886-63-3 |
| Synonyms | 3-(thiophen-2-yl)benzoic acid; 3-thiophen-2-ylbenzoate |
| InChI | InChI=1/C11H8O2S/c12-11(13)9-4-1-3-8(7-9)10-5-2-6-14-10/h1-7H,(H,12,13)/p-1 |
| Molecular Formula | C11H7O2S |
| Molecular Weight | 203.2376 |
| Melting point | 166℃ |
| Boiling point | 393.6°C at 760 mmHg |
| Flash point | 191.8°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
29886-63-3 3-(2-thienyl)benzoic acid
service@apichina.com