| Product Name | 3-(2-Thienyl)acrylic acid |
| CAS No. | 15690-25-2 |
| Synonyms | Thiophene-2-acrylic acid; 3-(2-Thiophenyl)propenoic acid; (2E)-3-thiophen-2-ylprop-2-enoate |
| InChI | InChI=1/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/p-1/b4-3+ |
| Molecular Formula | C7H5O2S |
| Molecular Weight | 153.1789 |
| Melting point | 145-148℃ |
| Boiling point | 298.9°C at 760 mmHg |
| Flash point | 134.6°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
15690-25-2 3-(2-thienyl)acrylic acid
service@apichina.com