| Product Name | 3-(2-oxocyclododecyl)propanoic acid |
| CAS No. | 22575-75-3 |
| InChI | InChI=1/C15H26O3/c16-14-10-8-6-4-2-1-3-5-7-9-13(14)11-12-15(17)18/h13H,1-12H2,(H,17,18) |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.3651 |
| Density | 0.985g/cm3 |
| Melting point | 88℃ |
| Boiling point | 421.8°C at 760 mmHg |
| Flash point | 223°C |
| Refractive index | 1.462 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
22575-75-3 3-(2-oxocyclododecyl)propanoic acid
service@apichina.com