| Product Name | 3-(2-nitrophenyl)-3-oxopropanenitrile |
| CAS No. | 40017-83-2 |
| InChI | InChI=1/C9H6N2O3/c10-6-5-9(12)7-3-1-2-4-8(7)11(13)14/h1-4H,5H2 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.1555 |
| Density | 1.332g/cm3 |
| Boiling point | 399.2°C at 760 mmHg |
| Flash point | 195.2°C |
| Refractive index | 1.578 |
40017-83-2 3-(2-nitrophenyl)-3-oxopropanenitrile
service@apichina.com