| Product Name | 3-(2-Naphthylthio)propionic acid |
| CAS No. | 1141-45-3 |
| Synonyms | 3-(2-Naphthylmercapto)propionic acid; 3-(naphthalen-2-ylsulfanyl)propanoic acid |
| InChI | InChI=1/C13H12O2S/c14-13(15)7-8-16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,7-8H2,(H,14,15) |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.2982 |
| Density | 1.27g/cm3 |
| Boiling point | 440.6°C at 760 mmHg |
| Flash point | 220.3°C |
| Refractive index | 1.668 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1141-45-3 3-(2-naphthylthio)propionic acid
service@apichina.com