| Product Name | 3-(2-methyl-3-furyl)-3-oxopropanenitrile |
| CAS No. | 158386-97-1 |
| Synonyms | 3-(2-methylfuran-3-yl)-3-oxopropanenitrile |
| InChI | InChI=1/C8H7NO2/c1-6-7(3-5-11-6)8(10)2-4-9/h3,5H,2H2,1H3 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.1467 |
| Density | 1.147g/cm3 |
| Melting point | 98℃ |
| Boiling point | 284°C at 760 mmHg |
| Flash point | 125.5°C |
| Refractive index | 1.495 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
158386-97-1 3-(2-methyl-3-furyl)-3-oxopropanenitrile
service@apichina.com