| Product Name | 3-(2-methyl-1,3-thiazol-4-yl)benzoic acid |
| CAS No. | 28077-41-0 |
| InChI | InChI=1/C11H9NO2S/c1-7-12-10(6-15-7)8-3-2-4-9(5-8)11(13)14/h2-6H,1H3,(H,13,14) |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.2597 |
| Density | 1.319g/cm3 |
| Melting point | 200℃ |
| Boiling point | 431°C at 760 mmHg |
| Flash point | 214.4°C |
| Refractive index | 1.629 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
28077-41-0 3-(2-methyl-1,3-thiazol-4-yl)benzoic acid
service@apichina.com