| Product Name | 3-(2-formyl-1H-pyrrol-1-yl)propanenitrile |
| CAS No. | 43036-05-1 |
| InChI | InChI=1/C8H8N2O/c9-4-2-6-10-5-1-3-8(10)7-11/h1,3,5,7H,2,6H2 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.1619 |
| Density | 1.07g/cm3 |
| Boiling point | 331.8°C at 760 mmHg |
| Flash point | 154.4°C |
| Refractive index | 1.546 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
43036-05-1 3-(2-formyl-1h-pyrrol-1-yl)propanenitrile
service@apichina.com