| Product Name | 3-(2-formyl-1H-pyrrol-1-yl)benzonitrile |
| CAS No. | 209958-45-2 |
| InChI | InChI=1/C12H8N2O/c13-8-10-3-1-4-11(7-10)14-6-2-5-12(14)9-15/h1-7,9H |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.2047 |
| Density | 1.13g/cm3 |
| Melting point | 145℃ |
| Boiling point | 377.4°C at 760 mmHg |
| Flash point | 182.1°C |
| Refractive index | 1.601 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
209958-45-2 3-(2-formyl-1h-pyrrol-1-yl)benzonitrile
service@apichina.com