| Product Name | 3-(2-Chlorophenyl)propionic acid |
| CAS No. | 1643-28-3 |
| Synonyms | Benzenepropanoic acid, 2-chloro-; 2-Chlorobenzenepropanoic acid; 3-(2-chlorophenyl)propanoic acid; 3-(2-chlorophenyl)propanoate |
| InChI | InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
| Molecular Formula | C9H8ClO2 |
| Molecular Weight | 183.6122 |
| Boiling point | 306.6°C at 760 mmHg |
| Flash point | 139.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1643-28-3 3-(2-chlorophenyl)propionic acid
service@apichina.com