| Product Name | 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride |
| CAS No. | 25629-50-9 |
| Synonyms | 3-(2-Chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride; 3-(o-Chlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride; CMIC Chloride |
| InChI | InChI=1/C11H7Cl2NO2/c1-6-9(11(13)15)10(14-16-6)7-4-2-3-5-8(7)12/h2-5H,1H3 |
| Molecular Formula | C11H7Cl2NO2 |
| Molecular Weight | 256.0848 |
| Density | 1.381g/cm3 |
| Boiling point | 381.7°C at 760 mmHg |
| Flash point | 184.6°C |
| Refractive index | 1.574 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
25629-50-9 3-(2-chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
service@apichina.com