| Product Name | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile |
| CAS No. | 175204-41-8 |
| Synonyms | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
| InChI | InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
| Molecular Formula | C11H8ClFN2OS |
| Molecular Weight | 270.7104 |
| Density | 1.426g/cm3 |
| Melting point | 85℃ |
| Boiling point | 408.4°C at 760 mmHg |
| Flash point | 200.8°C |
| Refractive index | 1.625 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175204-41-8 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile
service@apichina.com