| Product Name | 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carbothioamide |
| CAS No. | 175204-43-0 |
| Synonyms | 3-(2,6-Dichlorophenyl)5-methylisoxazole-4-carbothioamide |
| InChI | InChI=1/C11H8Cl2N2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
| Molecular Formula | C11H8Cl2N2OS |
| Molecular Weight | 287.165 |
| Density | 1.454g/cm3 |
| Melting point | 173℃ |
| Boiling point | 429.8°C at 760 mmHg |
| Flash point | 213.8°C |
| Refractive index | 1.65 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175204-43-0 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carbothioamide
service@apichina.com