| Product Name | 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid |
| CAS No. | 175278-51-0 |
| Synonyms | 3-[2-[(4-Chlorophenyl)thio]-5-nitrophenyl]acrylic acid; (2Z)-3-{2-[(4-chlorophenyl)sulfanyl]-5-nitrophenyl}prop-2-enoic acid |
| InChI | InChI=1/C15H10ClNO4S/c16-11-2-5-13(6-3-11)22-14-7-4-12(17(20)21)9-10(14)1-8-15(18)19/h1-9H,(H,18,19)/b8-1- |
| Molecular Formula | C15H10ClNO4S |
| Molecular Weight | 335.7622 |
| Density | 1.5g/cm3 |
| Melting point | 212℃ |
| Boiling point | 531.7°C at 760 mmHg |
| Flash point | 275.4°C |
| Refractive index | 1.694 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid
service@apichina.com