| Product Name | 3-(2,3,5,6-Tetramethylbenzoyl)acrylic acid |
| CAS No. | 22659-83-2 |
| Synonyms | (2E)-4-oxo-4-(2,3,5,6-tetramethylphenyl)but-2-enoic acid |
| InChI | InChI=1/C14H16O3/c1-8-7-9(2)11(4)14(10(8)3)12(15)5-6-13(16)17/h5-7H,1-4H3,(H,16,17)/b6-5+ |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.275 |
| Density | 1.12g/cm3 |
| Boiling point | 440.7°C at 760 mmHg |
| Flash point | 234.5°C |
| Refractive index | 1.554 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
22659-83-2 3-(2,3,5,6-tetramethylbenzoyl)acrylic acid
service@apichina.com