| Product Name | 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid |
| CAS No. | 74772-17-1 |
| InChI | InChI=1/C9H7NO2S/c11-9(12)8-7(3-6-13-8)10-4-1-2-5-10/h1-6H,(H,11,12) |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.2224 |
| Density | 1.37g/cm3 |
| Melting point | 174℃ |
| Boiling point | 377.3°C at 760 mmHg |
| Flash point | 182°C |
| Refractive index | 1.669 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
74772-17-1 3-(1h-pyrrol-1-yl)thiophene-2-carboxylic acid
service@apichina.com