| Product Name | 3-(1H-pyrrol-1-yl)benzoic acid |
| CAS No. | 61471-45-2 |
| Synonyms | 3-(1H-pyrrol-1-yl)benzoate |
| InChI | InChI=1/C11H9NO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H,(H,13,14)/p-1 |
| Molecular Formula | C11H8NO2 |
| Molecular Weight | 186.1873 |
| Melting point | 268℃ |
| Boiling point | 376.6°C at 760 mmHg |
| Flash point | 181.6°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
61471-45-2 3-(1h-pyrrol-1-yl)benzoic acid
service@apichina.com