| Product Name | 3-(1H-pyrrol-1-yl)benzene-1-carbothioamide |
| CAS No. | 175276-79-6 |
| Synonyms | 3-(1H-pyrrol-1-yl)benzenecarbothioamide |
| InChI | InChI=1/C11H10N2S/c12-11(14)9-4-3-5-10(8-9)13-6-1-2-7-13/h1-8H,(H2,12,14) |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.2755 |
| Density | 1.19g/cm3 |
| Melting point | 110℃ |
| Boiling point | 376.3°C at 760 mmHg |
| Flash point | 181.4°C |
| Refractive index | 1.646 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175276-79-6 3-(1h-pyrrol-1-yl)benzene-1-carbothioamide
service@apichina.com