| Product Name | (2Z)-2-{1-[7-chloro-9-(chloromethyl)-9H-thioxanthen-2-yl]ethylidene}hydrazinecarboxamide |
| CAS No. | 66949-59-5 |
| InChI | InChI=1/C17H15Cl2N3OS/c1-9(21-22-17(20)23)10-2-4-15-12(6-10)14(8-18)13-7-11(19)3-5-16(13)24-15/h2-7,14H,8H2,1H3,(H3,20,22,23)/b21-9- |
| Molecular Formula | C17H15Cl2N3OS |
| Molecular Weight | 380.2915 |
| Density | 1.483g/cm3 |
| Refractive index | 1.698 |
66949-59-5 (2z)-2-{1-[7-chloro-9-(chloromethyl)-9h-thioxanthen-2-yl]ethylidene}hydrazinecarboxamide
service@apichina.com