| Product Name | (2R,5R)-(-)-2,5-Hexanediol |
| CAS No. | 17299-07-9 |
| Synonyms | (2R,5R)-2,5-Hexanediol; Hexanediolcolorlessxtl; (2R,5R)-Dihydroxyhexane; (2R,5R)-hexane-2,5-diol |
| InChI | InChI=1/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.1742 |
| Density | 0.958g/cm3 |
| Melting point | 50-53℃ |
| Boiling point | 213.4°C at 760 mmHg |
| Flash point | 101.7°C |
| Refractive index | 1.445 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
17299-07-9 (2r,5r)-(-)-2,5-hexanediol
service@apichina.com