| Product Name | (2R,3S)-1-Carboxy-4-isopropyl-2,3-dihydrocyclohexa-4,6-diene potassium salt |
| CAS No. | 205652-50-2 |
| Synonyms | (5S,6R)-5,6-dihydroxy-4-(propan-2-yl)cyclohexa-1,3-diene-1-carboxylate |
| InChI | InChI=1/C10H14O4/c1-5(2)6-3-4-7(10(13)14)9(12)8(6)11/h3-5,8-9,11-12H,1-2H3,(H,13,14)/p-1/t8-,9+/m0/s1 |
| Molecular Formula | C10H13O4 |
| Molecular Weight | 197.2084 |
| Boiling point | 391.045°C at 760 mmHg |
| Flash point | 204.465°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
205652-50-2 (2r,3s)-1-carboxy-4-isopropyl-2,3-dihydrocyclohexa-4,6-diene potassium salt
service@apichina.com