| Product Name | 2H-chromene-3-carboxylic acid |
| CAS No. | 22649-28-1 |
| Synonyms | 2H-1-Benzopyran-3-carboxylicacid; 2H-chromene-3-carboxylate |
| InChI | InChI=1/C10H8O3/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8/h1-5H,6H2,(H,11,12)/p-1 |
| Molecular Formula | C10H8/sub>O3 |
| Molecular Weight | 1761613 |
| Melting point | 187℃ |
| Boiling point | 327.3°C at 760 mmHg |
| Flash point | 134.8°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
22649-28-1 2h-chromene-3-carboxylic acid
service@apichina.com