| Product Name | 2H-chromene-3-carbonyl chloride |
| CAS No. | 41873-72-7 |
| InChI | InChI=1/C10H7ClO2/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8/h1-5H,6H2 |
| Molecular Formula | C10H7ClO2 |
| Molecular Weight | 194.6144 |
| Density | 1.344g/cm3 |
| Melting point | 67℃ |
| Boiling point | 309.6°C at 760 mmHg |
| Flash point | 115.1°C |
| Refractive index | 1.593 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
41873-72-7 2h-chromene-3-carbonyl chloride
service@apichina.com