| Product Name | (2E,4E)-5-phenylpenta-2,4-dienoic acid |
| CAS No. | 1552-94-9 |
| Synonyms | Cinnamalacetic acid; 5-phenylpenta-2,4-dienoic acid |
| InChI | InChI=1/C11H10O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H,(H,12,13)/b8-4+,9-5+ |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.1959 |
| Density | 1.148g/cm3 |
| Boiling point | 356.1°C at 760 mmHg |
| Flash point | 257.6°C |
| Refractive index | 1.616 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1552-94-9 (2e,4e)-5-phenylpenta-2,4-dienoic acid
service@apichina.com