| Product Name | (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate |
| CAS No. | 83594-38-1 |
| Synonyms | 2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid; 2-(2-Formylamino-1,3-thiazol-4-yl)-2-(methoxyimino)acetic acid; 2-(Formylamino)-alpha-methoxyimino-4-thiazoleacetic acid; (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoic acid |
| InChI | InChI=1/C7H7N3O4S/c1-14-10-5(6(12)13)4-2-15-7(9-4)8-3-11/h2-3H,1H3,(H,12,13)(H,8,9,11)/p-1/b10-5+ |
| Molecular Formula | C7H6N3O4S |
| Molecular Weight | 228.2058 |
| Melting point | 160-165℃ |
| Boiling point | 438.5°C at 760 mmHg |
| Flash point | 219°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
83594-38-1 (2e)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate
service@apichina.com