| Product Name | 2-(trifluoromethylthio)aniline |
| CAS No. | 347-55-7 |
| Synonyms | 2-Aminophenyl trifluoromethyl sulphide; 4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
| InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
| Molecular Formula | C11H11FO4 |
| Molecular Weight | 226.201 |
| Density | 1.279g/cm3 |
| Boiling point | 422.6°C at 760 mmHg |
| Flash point | 209.4°C |
| Refractive index | 1.52 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
347-55-7 2-(trifluoromethylthio)aniline
service@apichina.com