| Product Name | 2-(tetrapropenyl)succinic acid, monoester with propane-1,2-diol |
| CAS No. | 52305-09-6 |
| Synonyms | Butanedioic acid, 2-(tetrapropenyl)-, monoester with 1,2-propanediol; Tetrapropenylsuccinic acid, 1,2-propanediol half eser; 2-(Tetrapropenyl)succinic acid, monoester with propane-1,2-diol; Butanedioic acid, (tetrapropenyl)-, monoester with 1,2-propanediol; 3-[(2-hydroxypropoxy)carbonyl]-2-prop-2-en-1-yl-2,3-dipropylhexanoic acid; 2-[2-(2-hydroxy-1-methyl-ethoxy)-2-oxo-ethyl]tetradecanoic acid |
| InChI | InChI=1/C19H36O5/c1-3-4-5-6-7-8-9-10-11-12-13-17(19(22)23)14-18(21)24-16(2)15-20/h16-17,20H,3-15H2,1-2H3,(H,22,23) |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.4861 |
| Density | 1.017g/cm3 |
| Boiling point | 494.2°C at 760 mmHg |
| Flash point | 164.6°C |
| Refractive index | 1.472 |
52305-09-6 2-(tetrapropenyl)succinic acid, monoester with propane-1,2-diol
service@apichina.com