| Product Name | 2-sec-butylcyclohexanone |
| CAS No. | 14765-30-1 |
| Synonyms | Cyclohexanone, 2-(1-methylpropyl)-; 2-(1-Methylpropyl)cyclohexanone; 2-sec-Butylcyclohexanone; BRN 1859137; Butylcyclohexanone, O-sec-; Cyclohexanone, 2-sec-butyl-; FEMA No. 3261; NSC 21146; UNII-5WA6R1KL5J; 2-sec-Butylcyclohexan-1-one; Cyclohexanone, 2-sec-butyl-; 2-(butan-2-yl)cyclohexanone; 2-(1-Methylpropyl)-Cyclohexanone |
| InChI | InChI=1/C10H18O/c1-3-8(2)9-6-4-5-7-10(9)11/h8-9H,3-7H2,1-2H3 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.2493 |
| Density | 0.899g/cm3 |
| Boiling point | 213.5°C at 760 mmHg |
| Flash point | 75.8°C |
| Refractive index | 1.452 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
14765-30-1 2-sec-butylcyclohexanone
service@apichina.com