| Product Name | 2-quinolylmethanol |
| CAS No. | 1780-17-2 |
| Synonyms | 2-Hydroxymethylquinoline; 2-Quinolinylmethanol; 2-Quinolinemethanol; quinolin-2-ylmethanol |
| InChI | InChI=1/C10H9NO/c12-7-9-6-5-8-3-1-2-4-10(8)11-9/h1-6,12H,7H2 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.1846 |
| Density | 1.218g/cm3 |
| Boiling point | 310.6°C at 760 mmHg |
| Flash point | 141.6°C |
| Refractive index | 1.667 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1780-17-2 2-quinolylmethanol
service@apichina.com