| Product Name | 2-quinolinecarbonitrile |
| CAS No. | 1436-43-7 |
| Synonyms | Quinoline-2-carbonitrile; 2-Cyanoquinoline |
| InChI | InChI=1/C10H6N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.168 |
| Density | 1.21g/cm3 |
| Melting point | 93-95℃ |
| Boiling point | 323.7°C at 760 mmHg |
| Flash point | 115.5°C |
| Refractive index | 1.654 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1436-43-7 2-quinolinecarbonitrile
service@apichina.com