| Product Name | 2-Pyrazinecarbonyl chloride |
| CAS No. | 19847-10-0 |
| Synonyms | Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
| InChI | InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
| Molecular Formula | C5H3ClN2O |
| Molecular Weight | 142.5431 |
| Density | 1.393g/cm3 |
| Melting point | 40.9℃ |
| Boiling point | 214.5°C at 760 mmHg |
| Flash point | 83.5°C |
| Refractive index | 1.551 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
19847-10-0 2-pyrazinecarbonyl chloride
service@apichina.com