| Product Name | 2-propylthiophene |
| CAS No. | 1551-27-5 |
| Synonyms | 2-N-PROPYLTHIOPHENE |
| InChI | InChI=1/C7H10S/c1-6(2)7-4-3-5-8-7/h3-6H,1-2H3 |
| Molecular Formula | C7H10S |
| Molecular Weight | 126.2193 |
| Density | 0.978g/cm3 |
| Boiling point | 153.6°C at 760 mmHg |
| Flash point | 30.1°C |
| Refractive index | 1.513 |
| Risk Codes | R10:Flammable.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
1551-27-5 2-propylthiophene
service@apichina.com
- Next:229-75-4 benzo[f]quinazoline
- Previous:229-72-1 benzo[f]phthalazine