| Product Name | 2-Propenoic acid, polymer with butyl 2-propenoate and ethyl 2-propenoate |
| CAS No. | 27322-15-2 |
| Synonyms | Ethyl acrylate, butyl acrylate, acrylic acid polymer; butyl prop-2-enoate; ethyl prop-2-enoate |
| InChI | InChI=1/C7H12O2.C5H8O2.C3H4O2/c1-3-5-6-9-7(8)4-2;1-3-5(6)7-4-2;1-2-3(4)5/h4H,2-3,5-6H2,1H3;3H,1,4H2,2H3;2H,1H2,(H,4,5) |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.3475 |
| Boiling point | 145.9°C at 760 mmHg |
| Flash point | 39.4°C |
27322-15-2 2-propenoic acid, polymer with butyl 2-propenoate and ethyl 2-propenoate
service@apichina.com