| Product Name | 2-Propanone, reaction products with diphenylamine |
| CAS No. | 68412-48-6 |
| Synonyms | Acetone diphenylamine condensation products; Acetone, diphenylamine condensation product; Diphenylamine, acetone reaction product; N-Phenylbenzeneamine, 2-propanone reaction product; propan-2-one-N-cyclohexylcyclohexanamine (1:1); propan-2-one-N-phenylaniline (1:1); Acetone Diphenylamine; Antioxidant BLE; Rubber Antioxidant BLE-W |
| InChI | InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.3016 |
| Boiling point | 302°C at 760 mmHg |
| Flash point | 152.8°C |
68412-48-6 2-propanone, reaction products with diphenylamine
service@apichina.com