| Product Name | 2-Piperidinophenol |
| CAS No. | 65195-20-2 |
| Synonyms | 2-(Piperidin-1-yl)phenol; phenol, 2-(1-piperidinyl)- |
| InChI | InChI=1/C11H15NO/c13-11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7,13H,1,4-5,8-9H2 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.2429 |
| Density | 1.106g/cm3 |
| Boiling point | 296.8°C at 760 mmHg |
| Flash point | 145.3°C |
| Refractive index | 1.575 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
65195-20-2 2-piperidinophenol
service@apichina.com