| Product Name | 2-Piperidinobenzonitrile |
| CAS No. | 72752-52-4 |
| Synonyms | 2-(1-Piperidino)benzonitrile; 2-piperidin-1-ylbenzonitrile |
| InChI | InChI=1/C12H14N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.253 |
| Density | 1.09g/cm3 |
| Melting point | 48-50℃ |
| Boiling point | 336.9°C at 760 mmHg |
| Flash point | 147.5°C |
| Refractive index | 1.577 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
72752-52-4 2-piperidinobenzonitrile
service@apichina.com