| Product Name | 2-(phenylthio)nicotinic acid |
| CAS No. | 35620-72-5 |
| Synonyms | 2-(phenylsulfanyl)pyridine-3-carboxylic acid; 2-(phenylsulfanyl)pyridine-3-carboxylate |
| InChI | InChI=1/C12H9NO2S/c14-12(15)10-7-4-8-13-11(10)16-9-5-2-1-3-6-9/h1-8H,(H,14,15)/p-1 |
| Molecular Formula | C12H8NO2S |
| Molecular Weight | 230.263 |
| Melting point | 170℃ |
| Boiling point | 407.4°C at 760 mmHg |
| Flash point | 200.2°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
35620-72-5 2-(phenylthio)nicotinic acid
service@apichina.com