| Product Name | 2-Phenylpropyl butyrate |
| CAS No. | 80866-83-7 |
| Synonyms | Butanoic acid, 2-phenylpropyl ester; FEMA No. 2891; Hydratropyl butyrate; Methylphenethyl butyrate, beta-; 2-phenylpropyl butanoate; (2S)-2-phenylpropyl butanoate; (2R)-2-phenylpropyl butanoate; 2-Phenyl-1-propyl butyrate |
| InChI | InChI=1/C13H18O2/c1-3-7-13(14)15-10-11(2)12-8-5-4-6-9-12/h4-6,8-9,11H,3,7,10H2,1-2H3/t11-/m0/s1 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.2808 |
| Density | 0.986g/cm3 |
| Boiling point | 276.8°C at 760 mmHg |
| Flash point | 104.6°C |
| Refractive index | 1.493 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
80866-83-7 2-phenylpropyl butyrate
service@apichina.com