| Product Name | 2-Phenylpropionaldehyde |
| CAS No. | 93-53-8 |
| Synonyms | 2-Phenylpropanal; alpha-methylphenylacetaldehyde; hydratopic aldehyde; Hydratropic aldehyde |
| InChI | InChI=1/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.1751 |
| Density | 0.98g/cm3 |
| Boiling point | 202.3°C at 760 mmHg |
| Flash point | 76.1°C |
| Refractive index | 1.505 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
93-53-8 2-phenylpropionaldehyde
service@apichina.com