| Product Name | 2-Phenylglycinonitrile hydrochloride |
| CAS No. | 53941-45-0 |
| Synonyms | alpha-Aminobenzyl cyanide hydrochloride~alpha-Aminophenylacetonitrile hydrochloride; (S)-cyano(phenyl)methanaminium; (R)-cyano(phenyl)methanaminium |
| InChI | InChI=1/C8H8N2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8H,10H2/p+1/t8-/m0/s1 |
| Molecular Formula | C8H9N2 |
| Molecular Weight | 133.1699 |
| Melting point | 158-165℃ |
| Boiling point | 235.8°C at 760 mmHg |
| Flash point | 96.4°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
53941-45-0 2-phenylglycinonitrile hydrochloride
service@apichina.com