| Product Name | 2-Phenylethyl-1-boronic acid |
| CAS No. | 34420-17-2 |
| Synonyms | Phenethylboronic acid; (2-phenylethyl)boronic acid; [(E)-2-phenylethenyl]boronic acid; 2-Phenylethaneboronic acid; Phenylethaneboronic Acid |
| InChI | InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
| Molecular Formula | C8H9BO2 |
| Molecular Weight | 147.9669 |
| Density | 1.13g/cm3 |
| Boiling point | 315.9°C at 760 mmHg |
| Flash point | 144.9°C |
| Refractive index | 1.587 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
34420-17-2 2-phenylethyl-1-boronic acid
service@apichina.com