| Product Name | 2-Phenylethyl-1-boronic acid diethanolamine cyclic ester |
| CAS No. | 4848-04-8 |
| Synonyms | 2-phenethyl-1,3,6,2-dioxazaborocane |
| InChI | InChI=1/C12H18BNO2/c1-2-4-12(5-3-1)6-7-13-15-10-8-14-9-11-16-13/h1-5,14H,6-11H2 |
| Molecular Formula | C12H18BNO2 |
| Molecular Weight | 219.0878 |
| Density | 1.03g/cm3 |
| Boiling point | 330.1°C at 760 mmHg |
| Flash point | 153.5°C |
| Refractive index | 1.506 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4848-04-8 2-phenylethyl-1-boronic acid diethanolamine cyclic ester
service@apichina.com